223465-76-7
Chemical Structure
Arborcandin A
- CAS No.: 223465-76-7
- Formula:C57H101N13O18
- Molecular Weight:1256.49
SMILES: NC(C(O)CC(NC([C@@H](C)NC([C@H](CC(N)=O)NC([C@@H](CC(N)=O)NC(C(CCCCCCCC(O)CCCC)NC(CCN1)=O)=O)=O)=O)=O)C(N[C@]([C@H](O)C)(C(N[C@@]([C@H](O)C)(C(NC(C(NCC1=O)=O)CCC(O)CCCCCCCCC)=O)[H])=O)[H])=O)=O
Biological Activity: Arborcandin A is a 1,3-β-glucan synthase inhibitor that serves as an antifungal antibiotic. Arborcandin A exhibits IC50 values of 0.25 μg/mL and 0.05 μg/mL against Candida albicans and Aspergillus fumigatus, respectively. Additionally, Arborcandin A has an MIC of 4-8 μg/mL against the genus Candida[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Arborcandin A | Arborcandin A is a 1,3-β-glucan synthase inhibitor that serves as an antifungal antibiotic. Arborcandin A exhibits IC50 values of 0.25 μg/mL and 0.05 μg/mL against Candida albicans and Aspergillus fumigatus, respectively. Additionally, Arborcandin A has an MIC of 4-8 μg/mL against the genus Candida. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
