2243206-95-1
Chemical Structure
Azido-PEG3-DYKDDDDK
Synonym(s): Azido-PEG3-FLAG
- CAS No.: 2243206-95-1
- Formula:C50H75N13O24
- Molecular Weight:1242.20
InChIKey: UBNDUTFMVNRKDR-VTGDPKQBSA-N
SMILES: OC(C=C1)=CC=C1C[C@H](NC([C@H](CC(O)=O)NC(CCOCCOCCOCCN=[N+]=[N-])=O)=O)C(N[C@@H](CCCCN)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@@H](CC(O)=O)C(N[C@H](C(O)=O)CCCCN)=O)=O)=O)=O)=O)=O
Biological Activity: Azido-PEG3-DYKDDDDK (azide-PEG3-FLAG) is a multifunctional fusion tag for the purification of recombinant proteins. Azido-PEG3-DYKDDDDK is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG3-DYKDDDDK | Azido-PEG3-DYKDDDDK (azide-PEG3-FLAG) is a multifunctional fusion tag for the purification of recombinant proteins. Azido-PEG3-DYKDDDDK is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
