2300952-67-2
Chemical Structure
Giraldoid B
- CAS No.: 2300952-67-2
- Formula:C24H20O13
- Molecular Weight:516.41
InChIKey: YDGYODBIBDSNTE-TUDFTFLDSA-N
SMILES: OC(C(O[C@@H]1O[C@@H]([C@H]([C@@H]([C@H]1O)O)O)CO)=C2)=C(C=CC(O3)=O)C3=C2OC4=C5C(C=CC(O5)=O)=CC=C4O
Biological Activity:
Giraldoid B is an active ingredient that can be isolated from Girald Daphne Bark. Giraldoid B can inhibit LPS induced NO and b>TNF-α production in RAW264.7 and has anti-inflammatory activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Giraldoid B | 98.49% | Giraldoid B is an active ingredient that can be isolated from Girald Daphne Bark. Giraldoid B can inhibit LPS induced NO and b>TNF-α production in RAW264.7 and has anti-inflammatory activity. |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||