2306413-51-2
Chemical Structure
Juncatrin B
- CAS No.: 2306413-51-2
- Formula:C18H16O2
- Molecular Weight:264.32
InChIKey: KLMPTWHNIJPCCY-UHFFFAOYSA-N
SMILES: C#CC1=C2CCC3=C(C=CC(O)=C3C)C2=CC(O)=C1C
Biological Activity: Juncatrin B is a type of dihydrophenanthrene compound. Juncatrin B exhibits inhibitory activity against both Methicillin (HY-121544)-sensitive Staphylococcus aureus (MSSA) and Methicillin-resistant Staphylococcus aureus (MRSA). Juncatrin B can inhibit the formation of biofilms in MSSA and MRSA. Juncatrin B has no significant activity against Gram-negative bacteria. Juncatrin B can be used in the research of anti-Staphylococcus aureus[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Juncatrin B | Juncatrin B is a type of dihydrophenanthrene compound. Juncatrin B exhibits inhibitory activity against both Methicillin (HY-121544)-sensitive Staphylococcus aureus (MSSA) and Methicillin-resistant Staphylococcus aureus (MRSA). Juncatrin B can inhibit the formation of biofilms in MSSA and MRSA. Juncatrin B has no significant activity against Gram-negative bacteria. Juncatrin B can be used in the research of anti-Staphylococcus aureus. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||