2353409-90-0
Chemical Structure
N-(Azido-PEG4)-N-bis(PEG4-NHS ester)
- CAS No.: 2353409-90-0
- Formula:C41H68N6O21
- Molecular Weight:981.01
IUPAC Name: bis(2,5-dioxopyrrolidin-1-yl) 16-(1-azido-3,6,9,12-tetraoxapentadecan-15-oyl)-4,7,10,13,19,22,25,28-octaoxa-16-azahentriacontanedioate
InChIKey: OYVKKJHNNQYSIS-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCN(CCOCCOCCOCCOCCC(ON(C1=O)C(CC1)=O)=O)C(CCOCCOCCOCCOCCN=[N+]=[N-])=O)ON(C2=O)C(CC2)=O
Biological Activity: N-(Azido-PEG4)-N-bis(PEG4-NHS ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-(Azido-PEG4)-N-bis(PEG4-NHS ester) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(Azido-PEG4)-N-bis(PEG4-NHS ester) | N-(Azido-PEG4)-N-bis(PEG4-NHS ester) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-(Azido-PEG4)-N-bis(PEG4-NHS ester) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||