24121-00-4
Chemical Structure
2'-O-methyladenosine 5'-phosphate
- CAS No.: 24121-00-4
- Formula:C11H16N5O7P
- Molecular Weight:361.25
InChIKey: TVGFEBXIZUYVFR-IOSLPCCCSA-N
SMILES: O[C@H]1[C@@H](OC)[C@H](N2C3=NC=NC(N)=C3N=C2)O[C@@H]1COP(O)(O)=O
Biological Activity: 2'-O-methyladenosine 5'-phosphate is the nucleotide complex group of ribosomes and is mainly used for DNA conjugation. 2'-O-methyladenosine 5'-phosphate is used to prepare RNA vaccines and is the main part of the RNA molecule, while the 5'-end is blocked by 2'-O-Methylguanosine 5'-monophosphate[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2'-O-methyladenosine 5'-phosphate | 2'-O-methyladenosine 5'-phosphate is the nucleotide complex group of ribosomes and is mainly used for DNA conjugation. 2'-O-methyladenosine 5'-phosphate is used to prepare RNA vaccines and is the main part of the RNA molecule, while the 5'-end is blocked by 2'-O-Methylguanosine 5'-monophosphate. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords