2434639-17-3
Chemical Structure
3,4-Dibromo-Mal-PEG4-Acid
- CAS No.: 2434639-17-3
- Formula:C15H21Br2NO8
- Molecular Weight:503.14
IUPAC Name: 1-(3,4-dibromo-2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3,6,9,12-tetraoxapentadecan-15-oic acid
InChIKey: JMJVXNRBNZBUFV-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCN1C(C(Br)=C(C1=O)Br)=O)O
Biological Activity: 3,4-Dibromo-Mal-PEG4-acid is a site specific ADC linker with a dibromomaleimide group and an acid group. The dibromomaleimide group allows for two points of substitution due to the two bromine atoms. The carboxylic acid can react with primary amines in the presence of EDC and HATU to form a stable amide bond. The hydrophilic PEG linker increases the water solubility of compounds in aqueous media.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3,4-Dibromo-Mal-PEG4-Acid | 95.20% | 3,4-Dibromo-Mal-PEG4-acid is a site specific ADC linker with a dibromomaleimide group and an acid group. The dibromomaleimide group allows for two points of substitution due to the two bromine atoms. The carboxylic acid can react with primary amines in the presence of EDC and HATU to form a stable amide bond. The hydrophilic PEG linker increases the water solubility of compounds in aqueous media. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||