2469244-77-5
Chemical Structure
Picolinafen-d4 (4-Fluorophenyl-d4)
- CAS. Nr.: 2469244-77-5
- Formula:C19H8D4F4N2O2
- Molecular Weight:380.33
IUPAC Name: N-(4-fluorophenyl-2,3,5,6-d4)-6-(3-(trifluoromethyl)phenoxy)picolinamide
InChIKey: CWKFPEBMTGKLKX-ULDPCNCHSA-N
SMILES: FC(C([2H])=C1[2H])=C([2H])C([2H])=C1NC(C2=NC(OC3=CC(C(F)(F)F)=CC=C3)=CC=C2)=O
Biological Activity: Picolinafen-d4 (4-fluorophenyl-d4) is the deuterium labeled Picolinafen[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Picolinafen-d4 (4-Fluorophenyl-d4) | Picolinafen-d4 (4-fluorophenyl-d4) is the deuterium labeled Picolinafen. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Picolinafen | Picolinafen is a pyridine-class herbicide that acts as a phytoene desaturase (PDS) inhibitor. Picolinafen effectively controls broadleaf weeds and disrupts carotenoid biosynthesis. Picolinafen exhibits cytotoxicity to porcine trophectoderm (pTr) and luminal epithelial (pLE) cells. Picolinafen induces (ROS accumulation, calcium depletion, and activates (MAPK and PI3K signaling pathways, leading to decreased cell viability, increased apoptosis, impaired migration, and altered expression of implantation-related genes. Picolinafen has an LD50 value of 2.7 mg/kg in mammals and 7 μg/L in fish. Picolinafen exhibits toxic effects during zebrafish embryogenesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||