2566-90-7
Chemical Structure
Docosahexaenoic acid methyl ester
Synonym(s): Methyl docosahexaenoate; all cis-DHA methyl ester
- CAS No.: 2566-90-7
- Formula:C23H34O2
- Molecular Weight:342.51
IUPAC Name: methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
InChIKey: VCDLWFYODNTQOT-JDPCYWKWSA-N
SMILES: CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(OC)=O
Biological Activity: Docosahexaenoic Acid methyl ester is a methylated docosahexaenoic acid analog which can be intercalated into membrane phospholipids without being oxidized or hydrolyzed.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Docosahexaenoic acid methyl ester | 99.82% | Docosahexaenoic Acid methyl ester is a methylated docosahexaenoic acid analog which can be intercalated into membrane phospholipids without being oxidized or hydrolyzed. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Docosahexaenoic acid methyl ester (Standard) | ≥98% | Docosahexaenoic acid methyl ester (Standard) is the analytical standard of Docosahexaenoic acid methyl ester. This product is intended for research and analytical applications. Docosahexaenoic Acid methyl ester is a methylated docosahexaenoic acid analog which can be intercalated into membrane phospholipids without being oxidized or hydrolyzed. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Docosahexaenoic acid-13C22 methyl ester | Docosahexaenoic acid-13C22 methyl ester is the 13C22 labeled Docosahexaenoic acid methyl ester (HY-101541). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Docosahexaenoic acid-d5 methyl ester | Docosahexaenoic acid-d5 methyl ester is the deuterium labeled Docosahexaenoic Acid methyl ester. Docosahexaenoic Acid methyl ester is a methylated docosahexaenoic acid analog which can be intercalated into membrane phospholipids without being oxidized or hydrolyzed. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||