2596867-40-0
Chemical Structure
Azido-PEG7-t-butyl ester
- CAS No.: 2596867-40-0
- Formula:C21H41N3O9
- Molecular Weight:479.56
IUPAC Name: tert-butyl 1-azido-3,6,9,12,15,18,21-heptaoxatetracosan-24-oate
InChIKey: KNNPWJYJJZETEL-UHFFFAOYSA-N
SMILES: O=C(CCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])OC(C)(C)C
Biological Activity: Azido-PEG7-t-butyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG7-t-butyl ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG7-t-butyl ester | Azido-PEG7-t-butyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG7-t-butyl ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
