2597167-22-9
Chemical Structure
Azido-PEG2-VHL
- CAS No.: 2597167-22-9
- Formula:C29H41N7O6S
- Molecular Weight:615.74
IUPAC Name: (2S,4R)-1-((S)-2-(3-(2-(2-azidoethoxy)ethoxy)propanamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide
InChIKey: FXRBDYWHWCJFLA-MVERNJQCSA-N
SMILES: [N-]=[N+]=NCCOCCOCCC(N[C@@H](C(C)(C)C)C(N1[C@@H](C[C@H](C1)O)C(NCC2=CC=C(C3=C(N=CS3)C)C=C2)=O)=O)=O
Biological Activity: Azido-PEG2-VHL is a multikinase degrader which can be used in the synthesis of PROTACs[1]. Azido-PEG2-VHL is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG2-VHL | Azido-PEG2-VHL is a multikinase degrader which can be used in the synthesis of PROTACs. Azido-PEG2-VHL is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
