2616-64-0
Chemical Structure
Uridine diphosphate glucuronic acid
Synonym(s): UDP-α-D-glucuronic acid
- CAS No.: 2616-64-0
- Formula:C15H22N2O18P2
- Molecular Weight:580.29
IUPAC Name: (2S,3S,4S,5R,6R)-6-(((((((2R,3S,4R,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methoxy)(hydroxy)phosphoryl)oxy)(hydroxy)phosphoryl)oxy)-3,4,5-trihydroxytetrahydro-2H-pyran-2-carboxylic acid
InChIKey: HDYANYHVCAPMJV-LXQIFKJMSA-N
SMILES: O[C@@H]1[C@@H](C(O)=O)O[C@H](OP(OP(OC[C@@H]2[C@@H](O)[C@@H](O)[C@H](N3C=CC(NC3=O)=O)O2)(O)=O)(O)=O)[C@H](O)[C@H]1O
Biological Activity: Uridine diphosphate glucuronic acid (UDP-α-D-glucuronic acid) is a glucuronic acid donor. Uridine diphosphate glucuronic acid transfers its glucuronic acid moiety to acceptor molecules, thereby forming "ether" glucuronides, while being converted into uridine 5'-pyrophosphate. Uridine diphosphate glucuronic acid serves as a substrate for Arabidopsis UDP-GlcA 4-epimerase 1, and undergoes reversible 4-epimerization to generate UDP-α-D-galacturonic acid[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Uridine diphosphate glucuronic acid | 98.0% | Uridine diphosphate glucuronic acid (UDP-α-D-glucuronic acid) is a glucuronic acid donor. Uridine diphosphate glucuronic acid transfers its glucuronic acid moiety to acceptor molecules, thereby forming "ether" glucuronides, while being converted into uridine 5'-pyrophosphate. Uridine diphosphate glucuronic acid serves as a substrate for Arabidopsis UDP-GlcA 4-epimerase 1, and undergoes reversible 4-epimerization to generate UDP-α-D-galacturonic acid. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uridine diphosphate glucuronic acid-13C,15N2 | Uridine diphosphate glucuronic acid-13C,15N2 (UDP-α-D-glucuronic acid-13C,15N2) is the 13C- and 15N-labeled Uridine diphosphate glucuronic acid (HY-125954). Uridine diphosphate glucuronic acid ammonium (UDP-α-D-glucuronic acid ammonium) is a glucuronic acid donor. Uridine diphosphate glucuronic acid ammonium transfers its glucuronic acid moiety to acceptor molecules, thereby forming "ether" glucuronides, while being converted into uridine 5'-pyrophosphate. Uridine diphosphate glucuronic acid ammonium serves as a substrate for Arabidopsis UDP-GlcA 4-epimerase 1, and undergoes reversible 4-epimerization to generate UDP-α-D-galacturonic acid. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. DUTTON GJ. Uridine diphosphate glucuronic acid as glucuronyl donor in the synthesis of ester, aliphatic and steroid glucuronides. Biochem J. 1956 Dec;64(4):693-701. [Content Brief]
- [2]. Gu X, et al. The biosynthesis of UDP-galacturonic acid in plants. Functional cloning and characterization of Arabidopsis UDP-D-glucuronic acid 4-epimerase. Plant Physiol. 2004 Dec;136(4):4256-64. [Content Brief]
