2646682-38-2
Chemical Structure
QKY-613
- CAS No.: 2646682-38-2
- Formula:C27H31N6O7P
- Molecular Weight:582.54
InChIKey: QIEZGNUDDMVHLT-MGPFDZOBSA-N
SMILES: O[C@H]1C[C@H](N(C=N2)C3=C2C(NC)=NC=N3)O[C@@H]1COP(OC4=CC=CC=C4)(N[C@H](C(OCC5=CC=CC=C5)=O)C)=O
Biological Activity: QKY-613 is a prodrug that enhances immune surveillance by targeting nucleic acid modification pathways. QKY-613 promotes the selective incorporation of 6mdA (N6-methyldeoxyadenosine) into viral DNA, enhancing the phase separation potential of DNA, thereby increasing the activation of cGAS and strengthening host immune surveillance. In virus-infected mouse models, QKY-613 significantly reduced mortality in aged mice. QKY-613 holds promise for research on nucleic acid modification-based immune surveillance mechanisms[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
QKY-613 | 98.24% | QKY-613 is a prodrug that enhances immune surveillance by targeting nucleic acid modification pathways. QKY-613 promotes the selective incorporation of 6mdA (N6-methyldeoxyadenosine) into viral DNA, enhancing the phase separation potential of DNA, thereby increasing the activation of cGAS and strengthening host immune surveillance. In virus-infected mouse models, QKY-613 significantly reduced mortality in aged mice. QKY-613 holds promise for research on nucleic acid modification-based immune surveillance mechanisms. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
