2749985-69-9
Chemical Structure
N-Fmoc-N'-(azido-PEG4)-L-Lysine-PFP ester
- CAS No.: 2749985-69-9
- Formula:C38H42F5N5O9
- Molecular Weight:807.76
IUPAC Name: perfluorophenyl (S)-21-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-1-azido-15-oxo-3,6,9,12-tetraoxa-16-azadocosan-22-oate
InChIKey: NOHZZMMQTNBKSR-LJAQVGFWSA-N
SMILES: FC(C(F)=C(C(F)=C1F)F)=C1OC([C@H](CCCCNC(CCOCCOCCOCCOCCN=[N+]=[N-])=O)NC(OCC2C3=CC=CC=C3C4=CC=CC=C42)=O)=O
Biological Activity: N-Fmoc-N'-(azido-PEG4)-L-Lysine-PFP ester is an alkyl/ether and PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. N-Fmoc-N'-(azido-PEG4)-L-Lysine-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Fmoc-N'-(azido-PEG4)-L-Lysine-PFP ester | 95.0% | N-Fmoc-N'-(azido-PEG4)-L-Lysine-PFP ester is an alkyl/ether and PEG-based PROTAC linker that can be used in the synthesis of PROTACs. N-Fmoc-N'-(azido-PEG4)-L-Lysine-PFP ester is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
