2761211-49-6
Chemical Structure
FGFR-IN-4
- CAS No.: 2761211-49-6
- Formula:C24H21N7O2
- Molecular Weight:439.47
IUPAC Name: (S)-1-(3-(4-amino-3-((2-cyclopropylbenzo[d]oxazol-5-yl)ethynyl)-1H-pyrazolo[3,4-d]pyrimidin-1-yl)pyrrolidin-1-yl)prop-2-en-1-one
InChIKey: LXRCUPIGSRXTCJ-INIZCTEOSA-N
SMILES: C=CC(N1CC[C@@H](C1)N2N=C(C3=C2N=CN=C3N)C#CC4=CC5=C(OC(C6CC6)=N5)C=C4)=O
Biological Activity: FGFR-IN-4 is a potent inhibitor of FGFR. Fibroblast growth factor receptor (FGFR) is a tyrosine kinase receptor that binds to fibroblast growth factor ligands. FGFR-IN-4 has the potential for the research of cancer diseases (extracted from patent WO2022033532A1, compound 20)[1]. FGFR-IN-4 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FGFR-IN-4 | FGFR-IN-4 is a potent inhibitor of FGFR. Fibroblast growth factor receptor (FGFR) is a tyrosine kinase receptor that binds to fibroblast growth factor ligands. FGFR-IN-4 has the potential for the research of cancer diseases (extracted from patent WO2022033532A1, compound 20). FGFR-IN-4 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||