2762750-70-7
Chemical Structure
FGFR-IN-5
- CAS No.: 2762750-70-7
- Formula:C25H22N6O3
- Molecular Weight:454.48
IUPAC Name: (S)-1-(1-acryloylpyrrolidin-3-yl)-4-amino-3-((2-cyclopropylbenzo[d]oxazol-5-yl)ethynyl)-1,6-dihydro-7H-pyrrolo[2,3-d]pyridazin-7-one
InChIKey: PFTXXXFDRVKUEE-KRWDZBQOSA-N
SMILES: C=CC(N1CC[C@@H](C1)N2C=C(C3=C2C(NN=C3N)=O)C#CC4=CC5=C(OC(C6CC6)=N5)C=C4)=O
Biological Activity: FGFR-IN-5 is a potent inhibitor of FGFR. Fibroblast growth factor receptor (FGFR) is a tyrosine kinase receptor that binds to fibroblast growth factor ligands. FGFR-IN-5 has the potential for the research of cancer diseases (extracted from patent WO2022042612A1, compound 3)[1]. FGFR-IN-5 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FGFR-IN-5 | FGFR-IN-5 is a potent inhibitor of FGFR. Fibroblast growth factor receptor (FGFR) is a tyrosine kinase receptor that binds to fibroblast growth factor ligands. FGFR-IN-5 has the potential for the research of cancer diseases (extracted from patent WO2022042612A1, compound 3). FGFR-IN-5 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
