2820046-26-0
Chemical Structure
FLAC6
- CAS No.: 2820046-26-0
- Formula:C21H28F13NO11
- Molecular Weight:717.43
InChIKey: SZAQBXSRVMHNKX-BUTOKUIXSA-N
SMILES: FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCNC([C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]1O[C@@H]([C@@H]([C@@H]([C@H]1O)O)O)CO)=O
Biological Activity: FLAC6 is a potent fluorinated detergent that can be used to solubilize membrane proteins (the native adenosine receptor A2AR, a G protein-coupled receptor, and two native transporters AcrB and BmrA). FLAC6 can maintain the structural and functional integrity of different membrane proteins[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FLAC6 | FLAC6 is a potent fluorinated detergent that can be used to solubilize membrane proteins (the native adenosine receptor A2AR, a G protein-coupled receptor, and two native transporters AcrB and BmrA). FLAC6 can maintain the structural and functional integrity of different membrane proteins. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||