2901804-30-4
Chemical Structure
BRM/BRG1 ATP degrader-1
- CAS No.: 2901804-30-4
- Formula:C29H34N8O
- Molecular Weight:510.65
IUPAC Name: 2-(6-amino-5-(8-(2-(4-(piperazin-1-yl)but-1-yn-1-yl)pyridin-4-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl)pyridazin-3-yl)phenol
InChIKey: OPEUTDZQERZKOL-UHFFFAOYSA-N
SMILES: OC1=CC=CC=C1C=2N=NC(N)=C(C2)N3CC4N(C=5C=CN=C(C#CCCN6CCNCC6)C5)C(C3)CC4
Biological Activity: BRM/BRG1 ATP degrader-1 is a phenol derivative that effectively degrades the BRM protein. BRM/BRG1 ATP degrader-1 exerts degradation-inhibiting effects on BRM IF and BRG1 IF in SW1573 cells. BRM/BRG1 ATP degrader-1 can be used in studies related to BRM-mediated diseases, such as non-small cell lung cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
BRM/BRG1 ATP degrader-1 | BRM/BRG1 ATP degrader-1 is a phenol derivative that effectively degrades the BRM protein. BRM/BRG1 ATP degrader-1 exerts degradation-inhibiting effects on BRM IF and BRG1 IF in SW1573 cells. BRM/BRG1 ATP degrader-1 can be used in studies related to BRM-mediated diseases, such as non-small cell lung cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||