2909407-29-8
Chemical Structure
Fisetin-d5
- CAS. Nr.: 2909407-29-8
- Formula:C15H5D5O6
- Molecular Weight:291.27
IUPAC Name: 2-(3,4-dihydroxyphenyl-2,5,6-d3)-3,7-dihydroxy-4H-chromen-4-one-6,8-d2
InChIKey: XHEFDIBZLJXQHF-UPLZBMDUSA-N
SMILES: OC1=C(C2=C([2H])C(O)=C(C([2H])=C2[2H])O)OC3=C([2H])C(O)=C([2H])C=C3C1=O
Biological Activity: Fisetin-d5 is a deuterated labeled Fisetin[1]. Fisetin is a natural flavonol found in many fruits and vegetables with various benefits, such as antioxidant, anticancer, neuroprotection effects.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Fisetin-d5 | 98.0% | Fisetin-d5 is a deuterated labeled Fisetin. Fisetin is a natural flavonol found in many fruits and vegetables with various benefits, such as antioxidant, anticancer, neuroprotection effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Fisetin (Standard) | 98.94% | Fisetin (Standard) is the analytical standard of Fisetin. This product is intended for research and analytical applications. Fisetin is a natural flavonol found in many fruits and vegetables with various benefits, such as antioxidant, anticancer, neuroprotection effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Fisetin | 99.90% | Fisetin is a natural flavonol found in many fruits and vegetables with various benefits, such as antioxidant, anticancer, neuroprotection effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||