30100-16-4
Chemical Structure
N-Boc-8-amino-octanoic acid
Synonym(s): Boc-8-aminooctanoic acid
- CAS No.: 30100-16-4
- Formula:C13H25NO4
- Molecular Weight:259.34
IUPAC Name: 8-((tert-butoxycarbonyl)amino)octanoic acid
InChIKey: FPRZYWCRQHFPSX-UHFFFAOYSA-N
SMILES: O=C(O)CCCCCCCNC(OC(C)(C)C)=O
Biological Activity: N-Boc-8-amino-octanoic acid (Boc-8-aminooctanoic acid) can be used as a PROTAC linker in the synthesis of PROTACs. N-Boc-8-amino-octanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Boc-8-amino-octanoic acid | 98.0% | N-Boc-8-amino-octanoic acid (Boc-8-aminooctanoic acid) can be used as a PROTAC linker in the synthesis of PROTACs. N-Boc-8-amino-octanoic acid is an alkane chain with terminal carboxlic acid and Boc-protected amino groups. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||