3056223-03-8
Chemical Structure
AK-968-11563024
- CAS. Nr.: 3056223-03-8
- Formula:C18H13I2N9O5
- Molecular Weight:689.16
SMILES: O=C(NNCC1=CC(I)=CC(I)=C1O)C(N=NN2C3=NON=C3N)=C2C4=CC=C([N+]([O-])=O)C=C4
Biological Activity: AK-968-11563024 is an inhibitor of marine V. vulnificus NAT [ (VIBVN)NAT] with an IC50 of 18.86 µM. NATs (Arylamine N-acetyltransferases) in marine V. vulnificus plays a role in drug metabolism, contributing to the development of drug resistance. Therefore, AK-968-11563024 can be utilized in research related to drug resistance[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
AK-968-11563024 | AK-968-11563024 is an inhibitor of marine V. vulnificus NAT [ (VIBVN)NAT] with an IC50 of 18.86 µM. NATs (Arylamine N-acetyltransferases) in marine V. vulnificus plays a role in drug metabolism, contributing to the development of drug resistance. Therefore, AK-968-11563024 can be utilized in research related to drug resistance. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||