3060653-05-3
Chemical Structure
Latalfapib alulocexetan
- CAS No.: 3060653-05-3
- Formula:C36H47AlFN9O8
- Molecular Weight:779.79
InChIKey: LYVOZYYJLAGVSX-LPCSYZHESA-K
SMILES: O=C(N1CCN(CC1)CCCOC2=CC3=C(C=C2)N=CC=C3C(NCC(N4[C@@H](CCC4)C#N)=O)=O)C[N]56CC[N]7(CC([O-][Al+3]768([F-])[O-]C9=O)=O)CC[N]8(C9)CC5
Biological Activity: Latalfapib alulocexetan is a molecule containing a metal-aluminum and fluorine coordination structure, which can be used as a diagnostic imaging agent for tumor imaging or targeted therapy[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Latalfapib alulocexetan | Latalfapib alulocexetan is a molecule containing a metal-aluminum and fluorine coordination structure, which can be used as a diagnostic imaging agent for tumor imaging or targeted therapy. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||