3070832-68-4
Chemical Structure
MRC71
- CAS No.: 3070832-68-4
- Formula:C43H66ClN5O8
- Molecular Weight:816.47
InChIKey: NRBOBAOLCBJHID-XWINOZFQSA-N
SMILES: O=C(C[C@H](N)C1=C(OC)C=CC=C1)N(C2)[C@H](C(N[C@@H](CC3=CC=NC=C3)C(NCCOCCOCCOCCOCCCCCCCl)=O)=O)C[C@H]2C4CCCCC4
Biological Activity:
MRC71 is a TRIMTAC degrader that recruits endogenous TRIM21 E3 ligase at one end and covalently binds to HaloTag-fusion target proteins at the other end. MRC71 selectively degrades oligomeric CAV1- and Cavin1-mEGFP-Halo, but not monomeric mEGFP-Halo, and exhibits a typical concentration-dependent degradation profile with a hook effect. MRC71 can be used to verify TRIMTAC ternary complex formation and state-selective degradation in cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
MRC71 | MRC71 is a TRIMTAC degrader that recruits endogenous TRIM21 E3 ligase at one end and covalently binds to HaloTag-fusion target proteins at the other end. MRC71 selectively degrades oligomeric CAV1- and Cavin1-mEGFP-Halo, but not monomeric mEGFP-Halo, and exhibits a typical concentration-dependent degradation profile with a hook effect. MRC71 can be used to verify TRIMTAC ternary complex formation and state-selective degradation in cells. |
|||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||