3091879-62-5
3091879-62-5
Chemical Structure
Cyanine 7.5 DBCO chloride
- No. CAS: 3091879-62-5
- Formula:C63H65ClN4O2
- Molecular Weight:945.67
InChIKey: VCTONEQYGCTMGV-UHFFFAOYSA-N
SMILES: O=C(N1CC(C=CC=C2)=C2C#CC3=C1C=CC=C3)CCCCCNC(CCCCC[N+](C(C=CC4=C5C=CC=C4)=C5C6(C)C)=C6/C=C/C=C/C=C/C=C7C(C)(C)C(C(C=CC=C8)=C8C=C9)=C9N\7C)=O.[Cl-]
Biological Activity: Cyanine 7.5 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 7.5 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 780/820 nm)[1].
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cyanine 7.5 DBCO chloride | Cyanine 7.5 DBCO chloride is a click chemistry reagent containing an cycloalkynes group. Cyanine 7.5 DBCO chloride is a linker of Cyanine5.5 fluorophore. DBCO group enables copper free biocompatible click chemistry with fast reaction kinetics and good stability (Ex/Em = 780/820 nm). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
