3112200-59-3
Chemical Structure
Dns–LLC
- CAS No.: 3112200-59-3
- Formula:C27H41N5O5S2
- Molecular Weight:579.77
InChIKey: DIROKIRVEAZPAK-FKBYEOEOSA-N
SMILES: CN(C)C(C1=CC=C2)=CC=CC1=C2S(=O)(N[C@H](C(N[C@@H](CC(C)C)C(N[C@@H](CS)C(N)=O)=O)=O)CC(C)C)=O
Biological Activity: Dns-LLC is a cell-permeable Cu+-selective fluorescent probe that forms a 1:1 complex with Cu+. The thiol group of Dns-LLC plays a key binding role, while the sulfonamide and amide groups jointly contribute to the stabilization of the complex. Upon binding to Cu+ in aqueous buffer solutions, Dns-LLC generates a turn-on fluorescence response, which can be used for the detection of Cu+ in the Golgi apparatus[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dns–LLC | Dns-LLC is a cell-permeable Cu+-selective fluorescent probe that forms a 1:1 complex with Cu+. The thiol group of Dns-LLC plays a key binding role, while the sulfonamide and amide groups jointly contribute to the stabilization of the complex. Upon binding to Cu+ in aqueous buffer solutions, Dns-LLC generates a turn-on fluorescence response, which can be used for the detection of Cu+ in the Golgi apparatus. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
