3119292-91-7
Chemical Structure
PROTAC GPX4 degrader-5
- CAS No.: 3119292-91-7
- Formula:C47H59ClN4O5S
- Molecular Weight:827.51
InChIKey: CVWWIJCJPWRDDY-HTOURRRRSA-N
SMILES: O=C(NCCC1=CC=CC=C1)C(C2=CC=CS2)N(C3=CC=C(C(Cl)=C3)OCC(NCCCCCCCCCCNC(CC4(C[C@@H]5C6)C[C@H](C5)C[C@H]6C4)=O)=O)C(C#C)=O
Biological Activity: PROTAC GPX4 degrader-5 (compound N15) is an efficient and highly selective PROTAC GPX4 degrader (DC50 = 28 nM). PROTAC GPX4 degrader-5 can induce ferroptosis and has low toxicity to normal cells. PROTAC GPX4 degrader-5 can significantly increase ROS. PROTAC GPX4 degrader-5 exerts anti proliferative effects on various tumor cells. PROTAC GPX4 degrader-5 is commonly used in cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PROTAC GPX4 degrader-5 | 95.0% | PROTAC GPX4 degrader-5 (compound N15) is an efficient and highly selective PROTAC GPX4 degrader (DC50 = 28 nM). PROTAC GPX4 degrader-5 can induce ferroptosis and has low toxicity to normal cells. PROTAC GPX4 degrader-5 can significantly increase ROS. PROTAC GPX4 degrader-5 exerts anti proliferative effects on various tumor cells. PROTAC GPX4 degrader-5 is commonly used in cancer research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||