325683-88-3
Chemical Structure
5'-DMTr-TNA-A(N-Bz)
- CAS. Nr.: 325683-88-3
- Formula:C37H33N5O6
- Molecular Weight:643.69
IUPAC Name: N-(9-((2R,3R,4R)-4-(bis(4-methoxyphenyl)(phenyl)methoxy)-3-hydroxytetrahydrofuran-2-yl)-9H-purin-6-yl)benzamide
InChIKey: IXZMSFIBBUTKQA-GXXFZFQXSA-N
SMILES: O[C@@H]1[C@@H](OC(C2=CC=C(OC)C=C2)(C3=CC=CC=C3)C4=CC=C(OC)C=C4)CO[C@H]1N(C=N5)C6=C5C(NC(C7=CC=CC=C7)=O)=NC=N6
Biological Activity: 5′-DMTr-TNA-A(N-Bz) (often supplied as a phosphoramidite building block) is a modified threose nucleic acid (TNA) monomer containing an adenine base with a benzoyl (Bz) protecting group and a 5'-dimethoxytrityl (DMTr) group, utilized in synthetic chemistry to construct artificial TNA oligomers for evolutionary and genetic research.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5'-DMTr-TNA-A(N-Bz) | 5′-DMTr-TNA-A(N-Bz) (often supplied as a phosphoramidite building block) is a modified threose nucleic acid (TNA) monomer containing an adenine base with a benzoyl (Bz) protecting group and a 5'-dimethoxytrityl (DMTr) group, utilized in synthetic chemistry to construct artificial TNA oligomers for evolutionary and genetic research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
