356046-26-9
Chemical Structure
Azido-PEG5-azide
- CAS No.: 356046-26-9
- Formula:C12H24N6O5
- Molecular Weight:332.36
IUPAC Name: 1,17-diazido-3,6,9,12,15-pentaoxaheptadecane
InChIKey: OQHIMLOZSDFRID-UHFFFAOYSA-N
SMILES: [N-]=[N+]=NCCOCCOCCOCCOCCOCCN=[N+]=[N-]
Biological Activity: Azido-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG5-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azido-PEG5-azide | 99.98% | Azido-PEG5-azide is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs. Azido-PEG5-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||