362589-95-5
Chemical Structure
Antiproliferative agent-12
- CAS No.: 362589-95-5
- Formula:C46H40Cl2N6P2Ru
- Molecular Weight:910.79
IUPAC Name: 1-(bromomethyl)cyclobutan-1-ol
SMILES: [H]c12n3cccn3[Ru+](n4n2ccc4)(Cl)([P](C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)([P](C8=CC=CC=C8)(C9=CC=CC=C9)C%10=CC=CC=C%10)n%11n1ccc%11.[Cl-]
Biological Activity: Antiproliferative agent-10 (compound 1) is an anti-tumour ruthenium(II)-tris-pyrazolylmethane complex that inhibits the growth of cancer cells by inhibiting mitochondrial calcium uptake[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Antiproliferative agent-12 | Antiproliferative agent-10 (compound 1) is an anti-tumour ruthenium(II)-tris-pyrazolylmethane complex that inhibits the growth of cancer cells by inhibiting mitochondrial calcium uptake. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords