529-69-1
Chemical Structure
Isoxanthopterin
- CAS No.: 529-69-1
- Formula:C6H5N5O2
- Molecular Weight:179.14
IUPAC Name: 2-Aminopteridine-4,7(1H,8H)-dione
InChIKey: GLKCOBIIZKYKFN-UHFFFAOYSA-N
SMILES: O=C1C(N=C2)=C(NC(N)=N1)NC2=O
Biological Activity: Isoxanthopterin is a heterocyclic compound belonging to the pteridine family and its activity is mainly reflected in its optical properties. Isoxanthopterin can form a reflective layer in the eyes of animals, enhancing visual function. The main regulatory mechanism of isoxanthopterin involves its ability to form a crystalline structure within organisms, which achieves a high refractive index through specific hydrogen bonding patterns and molecular arrangements. Isoxanthopterin can be used for research in materials science and optical engineering[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Isoxanthopterin | 99.68% | Isoxanthopterin is a heterocyclic compound belonging to the pteridine family and its activity is mainly reflected in its optical properties. Isoxanthopterin can form a reflective layer in the eyes of animals, enhancing visual function. The main regulatory mechanism of isoxanthopterin involves its ability to form a crystalline structure within organisms, which achieves a high refractive index through specific hydrogen bonding patterns and molecular arrangements. Isoxanthopterin can be used for research in materials science and optical engineering. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
