53016-31-2
Chemical Structure
Norgestimate metabolite Norelgestromin
Synonym(s): 17-Deacetyl norgestimate; 17-Deacylnorgestimate
- CAS No.: 53016-31-2
- Formula:C21H29NO2
- Molecular Weight:327.46
IUPAC Name: (8R,9S,10R,13S,14S,17R,E)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-3H-cyclopenta[a]phenanthren-3-one oxime
InChIKey: ISHXLNHNDMZNMC-VTKCIJPMSA-N
SMILES: O/N=C1CC[C@@]2([H])C(CC[C@]3([H])[C@]2([H])CC[C@@]4(CC)[C@@]3([H])CC[C@]4(C#C)O)=C\1
Biological Activity: Norgestimate metabolite Norelgestromin (17-Deacetyl norgestimate) is a metabolite of Norgestimate (HY-W013172). Norgestimate metabolite Norelgestromin is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Norgestimate metabolite Norelgestromin | 99.86% | Norgestimate metabolite Norelgestromin (17-Deacetyl norgestimate) is a metabolite of Norgestimate (HY-W013172). Norgestimate metabolite Norelgestromin is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Norgestimate metabolite Norelgestromin (Standard) | ≥98% | Norgestimate metabolite Norelgestromin (Standard) is the analytical standard of Norgestimate metabolite Norelgestromin. This product is intended for research and analytical applications. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Norgestimate metabolite norelgestromin-d6 | 99.90% | Norgestimate metabolite norelgestromin-d6 is the deuterium labeled Norgestimate metabolite norelgestromin. Norelgestromin is a metabolite of Norgestimate, which is a progestin or synthetic progestogen. Norgestimate metabolite norelgestromin-d6 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
