53696-59-6
Chemical Structure
8-Azido-ATP
Synonym(s): 8-Azidoadenosine 5'-triphosphate; 8-N3-ATP
- CAS No.: 53696-59-6
- Formula:C10H15N8O13P3
- Molecular Weight:548.19
IUPAC Name: (((2R,3S,4R,5R)-5-(6-amino-8-azido-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl)triphosphoric acid
InChIKey: PQISXOFEOCLOCT-UUOKFMHZSA-N
SMILES: O[C@H]1[C@@H](O)[C@H](N2C(N=[N+]=[N-])=NC3=C(N=CN=C32)N)O[C@@H]1COP(O)(OP(OP(O)(O)=O)(O)=O)=O
Biological Activity: 8-Azido-ATP, a photoreactable nucleotide analog, is useful for the identification of proteins, such as DNA-dependent RNA polymerase[1]. 8-Azido-ATP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
8-Azido-ATP | 8-Azido-ATP, a photoreactable nucleotide analog, is useful for the identification of proteins, such as DNA-dependent RNA polymerase. 8-Azido-ATP is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||