54651-05-7
Chemical Structure
Echinocandin B (purity>85%)
Synonym(s): SL 7810 (purity>85%); A-30912 A (purity>85%)
- CAS No.: 54651-05-7
- Formula:C52H81N7O16
- Molecular Weight:1060.24
InChIKey: FAUOJMHVEYMQQG-HVYQDZECSA-N
SMILES: O=C([C@](NC([C@](NC([C@@](C[C@H]1O)([H])N(C1)C2=O)=O)([H])[C@H](O)[C@H](C(C=C3)=CC=C3O)O)=O)([H])[C@H](O)C)N(C[C@@H]4C)[C@@](C(N[C@@H]([C@@H](C[C@@H](C(N[C@@]2([H])[C@H](O)C)=O)NC(CCCCCCC/C=C\C/C=C\CCCCC)=O)O)O)=O)([H])[C@H]4O
Biological Activity: Echinocandin B (purity>85%) (SL 7810 (purity>85%)) is a lipopeptide antifungal antibiotic. Echinocandin B (purity>85%) is produced by Aspergillus nidulans. Echinocandin B (purity>85%) inhibits β-1,3-glucan activity, thereby blocking the biosynthesis of fungal cell walls. Echinocandin B (purity>85%) exhibits activity against a variety of Aspergillus species[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Echinocandin B (purity>85%) | Echinocandin B (purity>85%) (SL 7810 (purity>85%)) is a lipopeptide antifungal antibiotic. Echinocandin B (purity>85%) is produced by Aspergillus nidulans. Echinocandin B (purity>85%) inhibits β-1,3-glucan activity, thereby blocking the biosynthesis of fungal cell walls. Echinocandin B (purity>85%) exhibits activity against a variety of Aspergillus species. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Echinocandin B (purity>65%) | Echinocandin B (purity>65%) (SL 7810 (purity>65%)) is a lipopeptide antifungal antibiotic. Echinocandin B (purity>65%) is produced by Aspergillus nidulans. Echinocandin B (purity>65%) inhibits β-1,3-glucan activity, thereby blocking the biosynthesis of fungal cell walls. Echinocandin B (purity>65%) exhibits activity against a variety of Aspergillus species. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Echinocandin B | Echinocandin B (SL 7810) is a lipopeptide antifungal antibiotic. Echinocandin B is produced by Aspergillus nidulans. Echinocandin B inhibits β-1,3-glucan activity, thereby blocking the biosynthesis of fungal cell walls. Echinocandin B exhibits activity against a variety of Aspergillus species. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
