59090-48-1
Chemical Structure
5-Azidomethyl-2'-deoxyuridine
Synonym(s): 5-AmdU; α-Azidothymidine
- CAS No.: 59090-48-1
- Formula:C10H13N5O5
- Molecular Weight:283.24
IUPAC Name: 5-(azidomethyl)-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione
InChIKey: JKSAKMHLWMCADM-XLPZGREQSA-N
SMILES: O=C(C(CN=[N+]=[N-])=CN1[C@H]2C[C@H](O)[C@@H](CO)O2)NC1=O
Biological Activity: 5-Azidomethyl-2'-deoxyuridine (5-AmdU) is a purine nucleoside analog. 5-Azidomethyl-2'-deoxyuridine demonstrates effective radiosensitization in EMT6 tumor cells.[1]. 5-Azidomethyl-2'-deoxyuridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
5-Azidomethyl-2'-deoxyuridine | 99.76% | 5-Azidomethyl-2'-deoxyuridine (5-AmdU) is a purine nucleoside analog. 5-Azidomethyl-2'-deoxyuridine demonstrates effective radiosensitization in EMT6 tumor cells.. 5-Azidomethyl-2'-deoxyuridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
