59158-14-4
Chemical Structure
Methyltrioctylammonium hydrogen sulfate
- CAS No.: 59158-14-4
- Formula:C25H55NO4S
- Molecular Weight:465.77
IUPAC Name: N-methyl-N,N-dioctyloctan-1-aminium hydrogen sulfate
InChIKey: MWSPFHZPVVWJCO-UHFFFAOYSA-M
SMILES: CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC.OS(=O)(=O)[O-]
Biological Activity: Methyltrioctylammonium hydrogen sulfate is a quaternary ammonium salt that is mainly used as an extraction solvent and a phase transfer catalyst in various chemical reactions. It is also used as an electrolyte in electrochemical devices such as batteries and fuel cells, and as a building block for the synthesis of pharmaceuticals and agrochemicals. MTOAHS are multifunctional compounds with many potential industrial applications due to their reactivity, stability, and ability to selectively extract certain compounds from mixtures.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Methyltrioctylammonium hydrogen sulfate | 97.0% | Methyltrioctylammonium hydrogen sulfate is a quaternary ammonium salt that is mainly used as an extraction solvent and a phase transfer catalyst in various chemical reactions. It is also used as an electrolyte in electrochemical devices such as batteries and fuel cells, and as a building block for the synthesis of pharmaceuticals and agrochemicals. MTOAHS are multifunctional compounds with many potential industrial applications due to their reactivity, stability, and ability to selectively extract certain compounds from mixtures. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
