59720-07-9
Chemical Structure
3-Aminopropan-1-ol-d6
Synonym(s): NSC 7766-d6;Propanolamine-d6
- CAS No.: 59720-07-9
- Formula:C3H3D6NO
- Molecular Weight:81.15
IUPAC Name: ethyl 4-bromo-2-(methylthio)pyrimidine-5-carboxylate
InChIKey: WUGQZFFCHPXWKQ-NMFSSPJFSA-N
SMILES: [2H]C([2H])(N)C([2H])([2H])C([2H])(O)[2H]
Biological Activity: 3-Aminopropan-1-ol-d6 (NSC 7766-d6; Propanolamine-d6) is the d6-labeled 3-Aminopropan-1-ol (HY-Y0139). 3-Aminopropan-1-ol is both a primary amine and a primary alcohol, and it is widely used as a versatile chemical building block and molecular linker[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
3-Aminopropan-1-ol-d6 | 98.0% | 3-Aminopropan-1-ol-d6 (NSC 7766-d6; Propanolamine-d6) is the d6-labeled 3-Aminopropan-1-ol (HY-Y0139). 3-Aminopropan-1-ol is both a primary amine and a primary alcohol, and it is widely used as a versatile chemical building block and molecular linker. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
3-Aminopropan-1-ol | 99.76% | 3-Aminopropan-1-ol is both a primary amine and a primary alcohol, and it is widely used as a versatile chemical building block and molecular linker. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||