6209-65-0
Chemical Structure
Heliotrine N-oxide
- CAS No.: 6209-65-0
- Formula:C16H27NO6
- Molecular Weight:329.39
IUPAC Name: (1S,7aR)-1-hydroxy-7-((((2S,3R)-2-hydroxy-2-isopropyl-3-methoxybutanoyl)oxy)methyl)-2,3,5,7a-tetrahydropyrrolizine 4(1H)-oxide
InChIKey: QSTHEUSPIBEICI-MCAMCBDESA-N
SMILES: [O-][N+]1(CC[C@@H]2O)[C@]2([H])C(COC([C@@](C(C)C)(O)[C@@H](C)OC)=O)=CC1
Biological Activity: Heliotrine N-oxide is the corresponding PA (pyrrolizidine alkaloid) N-oxide of Heliotrine (HY-126128). Heliotrine N-oxide leads to the formation of pyrrolic DNA adducts and potential initiation of PA-induced liver tumors in vivo[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Heliotrine N-oxide | Heliotrine N-oxide is the corresponding PA (pyrrolizidine alkaloid) N-oxide of Heliotrine (HY-126128). Heliotrine N-oxide leads to the formation of pyrrolic DNA adducts and potential initiation of PA-induced liver tumors in vivo. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||