64191-06-6
Chemical Structure
4-N-Maleimidobenzoicacid-NHS
- CAS No.: 64191-06-6
- Formula:C15H10N2O6
- Molecular Weight:314.25
IUPAC Name: 2,5-dioxopyrrolidin-1-yl 4-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)benzoate
InChIKey: GSYZMVGSEGJHGT-UHFFFAOYSA-N
SMILES: O=C(C1=CC=C(N2C(C=CC2=O)=O)C=C1)ON3C(CCC3=O)=O
Biological Activity: 4-N-Maleimidobenzoicacid-NHS is a PEG linker that finds utility in bioconjugation endeavors and protein labeling ventures. Specifically designed for selective reaction with thiol groups, the maleimide group establishes covalent linkages, thereby facilitating the coupling of proteins, peptides, or diverse molecules to thiol-bearing biomolecules. The NHS ester is able to react specifically and efficiently with primary amines (e.g. the side chain of lysine residues or aminosilane-coated surfaces) at neutral or slightly basic conditions to form a covalent bond.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-N-Maleimidobenzoicacid-NHS | 99.14% | 4-N-Maleimidobenzoicacid-NHS is a PEG linker that finds utility in bioconjugation endeavors and protein labeling ventures. Specifically designed for selective reaction with thiol groups, the maleimide group establishes covalent linkages, thereby facilitating the coupling of proteins, peptides, or diverse molecules to thiol-bearing biomolecules. The NHS ester is able to react specifically and efficiently with primary amines (e.g. the side chain of lysine residues or aminosilane-coated surfaces) at neutral or slightly basic conditions to form a covalent bond. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords