64502-82-5
Chemical Structure
Rhodirubin B
- CAS No.: 64502-82-5
- Formula:C42H55NO15
- Molecular Weight:813.88
InChIKey: VGXIKBCXEHBHIQ-DBKSDKBWSA-N
SMILES: COC([C@@H]([C@](O)(C1)CC)C(C=C2C(C(C3=C(O)C=CC(O)=C3C2=O)=O)=C4O)=C4[C@H]1O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O[C@@H]6O[C@H]([C@H](CC6)O[C@@H]7O[C@H]([C@H](CC7)O)C)C)N(C)C)=O
Biological Activity: Rhodirubin B has a strong anti-Gram-positive bacteria effect, and also has an effect on Mycobacterium. Rhodirubin B can also prolong the survival time of mice inoculated with leukemia L-1210[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rhodirubin B | Rhodirubin B has a strong anti-Gram-positive bacteria effect, and also has an effect on Mycobacterium. Rhodirubin B can also prolong the survival time of mice inoculated with leukemia L-1210. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||