68373-95-5
Chemical Structure
Mazethramycin B
- CAS No.: 68373-95-5
- Formula:C18H21N3O4
- Molecular Weight:343.38
SMILES: O=C(NC)/C=C/C1=CN2C(C3=CC=C(C)C(O)=C3NC(C2C1)OC)=O
Biological Activity: Mazethramycin B (Compound II) is an antitumor antibiotic. Mazethramycin B can be isolated from the Streptomyces thioluteusM ME561-L4. Mazethramycin B has a broad-spectrum antimicrobial activity (such as MICs of 1.56 and 6.25 μg/mL for the bacteria Bacillus subtilis PCI 219 and the fungus Candida pseudotropicalis, resepectively). Mazethramycin B significantly increases survival in L1210 leukemia mice model[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Mazethramycin B | Mazethramycin B (Compound II) is an antitumor antibiotic. Mazethramycin B can be isolated from the Streptomyces thioluteusM ME561-L4. Mazethramycin B has a broad-spectrum antimicrobial activity (such as MICs of 1.56 and 6.25 μg/mL for the bacteria Bacillus subtilis PCI 219 and the fungus Candida pseudotropicalis, resepectively). Mazethramycin B significantly increases survival in L1210 leukemia mice model. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords