694515-65-6
Chemical Structure
Rac1-IN-5
- CAS No.: 694515-65-6
- Formula:C24H26N2O5S2
- Molecular Weight:486.60
IUPAC Name: N-(4-(N-(2,5-dimethoxyphenyl)sulfamoyl)phenyl)-3-(p-tolylthio)propanamide
InChIKey: YXBJMDMSTRMFRE-UHFFFAOYSA-N
SMILES: CC1=CC=C(C=C1)SCCC(NC2=CC=C(C=C2)S(NC3=CC(OC)=CC=C3OC)(=O)=O)=O
Biological Activity: Rac1-IN-5 is a specific, reversible inhibitor of RAC1 (KD = 30 nM). Rac1-IN-5 competes with guanine nucleotides for specific binding to RAC proteins, effectively blocking RAC1 activity and RAC1-dependent cellular functions. Rac1-IN-5 exhibits anti-tumor metastasis effects in vivo and can improve survival. Rac1-IN-5 can be used to study invasive cancers such as triple-negative breast cancer and colon cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Rac1-IN-5 | 99.84% | Rac1-IN-5 is a specific, reversible inhibitor of RAC1 (KD = 30 nM). Rac1-IN-5 competes with guanine nucleotides for specific binding to RAC proteins, effectively blocking RAC1 activity and RAC1-dependent cellular functions. Rac1-IN-5 exhibits anti-tumor metastasis effects in vivo and can improve survival. Rac1-IN-5 can be used to study invasive cancers such as triple-negative breast cancer and colon cancer. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||