72152-49-9
Chemical Structure
Reactive red 124
- CAS No.: 72152-49-9
- Formula:C27H14ClF2N6Na3O11S3
- Molecular Weight:837.05
IUPAC Name: sodium 5-(4-((5-chloro-2,6-difluoropyrimidin-4-yl)amino)benzamido)-4-hydroxy-3-((2-sulfonatophenyl)diazenyl)naphthalene-2,7-disulfonate
InChIKey: DTJYROFTDDFIPE-UHFFFAOYSA-K
SMILES: O=S(C1=C(N=NC2=CC=CC=C2S(=O)(O[Na])=O)C(O)=C3C(NC(C4=CC=C(NC5=NC(F)=NC(F)=C5Cl)C=C4)=O)=CC(S(=O)(O[Na])=O)=CC3=C1)(O[Na])=O
Biological Activity: Reactive red 124 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Reactive red 124 | Reactive red 124 is common textile dyes that can be adsorbed onto single-walled carbon nanotubes (SWCNTs) through electrostatic interactions, allowing the separation of residual dyes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||