75179-85-0
Chemical Structure
S-Acetonyl-CoA
Synonym(s): Acetonyl-coenzyme A
- CAS No.: 75179-85-0
- Formula:C24H40N7O17P3S
- Molecular Weight:823.60
InChIKey: GAMKENBUYYJLCQ-NDZSKPAWSA-N
SMILES: NC1=C(C2=NC=N1)N=CN2[C@@H]3O[C@H](COP(OP(OCC(C)(C)[C@@H](O)C(NCCC(NCCSCC(C)=O)=O)=O)(O)=O)(O)=O)[C@@H](OP(O)(O)=O)[C@H]3O
Biological Activity: S-Acetonyl-CoA (Acetonyl-coenzyme A) is a non-reactive structural analog of acetyl-CoA that acts as a competitive inhibitor against multiple target enzymes. S-Acetonyl-CoA lacks the characteristic thioester group of acetyl-CoA, retaining only a thioether structure. S-Acetonyl-CoA competes with acetyl-CoA for binding to citrate synthase, phosphate transacetylase, carnitine acetyltransferase, and N-myristoyltransferase 1. S-Acetonyl-CoA serves as a reagent for investigating acetyl-CoA-dependent physiological processes[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
S-Acetonyl-CoA | S-Acetonyl-CoA (Acetonyl-coenzyme A) is a non-reactive structural analog of acetyl-CoA that acts as a competitive inhibitor against multiple target enzymes. S-Acetonyl-CoA lacks the characteristic thioester group of acetyl-CoA, retaining only a thioether structure. S-Acetonyl-CoA competes with acetyl-CoA for binding to citrate synthase, phosphate transacetylase, carnitine acetyltransferase, and N-myristoyltransferase 1. S-Acetonyl-CoA serves as a reagent for investigating acetyl-CoA-dependent physiological processes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||