81381-67-1
Chemical Structure
Sanggenon B
Synonym(s): Sanggenone B
- CAS No.: 81381-67-1
- Formula:C33H30O9
- Molecular Weight:570.59
SMILES: C/C(C)=C/CC1(C2=O)C(O)(OC(C=C3O)=C2C(O)=C3C4=C[C@@]5(C)C[C@H](C6=CC=C(O)C=C6O5)C4)C7=CC=C(O)C=C7O1
Biological Activity: Sanggenon B (Sanggenone B) is a compound that can be extracted from mulberry trees and has an inhibitory effect on NO production in RAW264.7 cells stimulated by LPS (HY-D1056). Sanggenon B has anti-inflammatory activity[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Sanggenon B | Sanggenon B (Sanggenone B) is a compound that can be extracted from mulberry trees and has an inhibitory effect on NO production in RAW264.7 cells stimulated by LPS (HY-D1056). Sanggenon B has anti-inflammatory activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords