86890-95-1
Chemical Structure
N-(p-Tosyl)-GPR-pNA acetate
Synonym(s): Chromozym-TH
- CAS No.: 86890-95-1
- Formula:C28H38N8O9S
- Molecular Weight:662.71
IUPAC Name: (S)-N-((S)-5-guanidino-1-((4-nitrophenyl)amino)-1-oxopentan-2-yl)-1-(tosylglycyl)pyrrolidine-2-carboxamide acetate
InChIKey: NGXDRWVTRQRSED-VROPFNGYSA-N
SMILES: O=C([C@H](CCC1)N1C(CN[S](=O)(C(C=C2)=CC=C2C)=O)=O)N[C@@H](CCCNC(N)=N)C(NC(C=C3)=CC=C3[N](=O)=O)=O.CC(O)=O
Biological Activity: N-(p-Tosyl)-GPR-pNA acetate (Chromozym-TH) is a chromogenic substrate targeting the synthetic peptides Hirunorm IV and Hirunorm V and can be used to detect the dissociation constants (KI) of both peptides. Hirunorm IV and Hirunorm V are reversible inhibitors of amidolytic thrombin activity. By varying the peptide concentration at a fixed concentration of the chromogenic substrate N-(p-Tosyl)-GPR-pNA acetate, the dissociation constants determined were 0.134 nM (Hirunorm IV) and 0.245 nM (Hirunorm V)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-(p-Tosyl)-GPR-pNA acetate | 99.68% | N-(p-Tosyl)-GPR-pNA acetate (Chromozym-TH) is a chromogenic substrate targeting the synthetic peptides Hirunorm IV and Hirunorm V and can be used to detect the dissociation constants (KI) of both peptides. Hirunorm IV and Hirunorm V are reversible inhibitors of amidolytic thrombin activity. By varying the peptide concentration at a fixed concentration of the chromogenic substrate N-(p-Tosyl)-GPR-pNA acetate, the dissociation constants determined were 0.134 nM (Hirunorm IV) and 0.245 nM (Hirunorm V). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
