878204-96-7
Chemical Structure
IPI-269609
- CAS No.: 878204-96-7
- Formula:C28H41NO2
- Molecular Weight:423.63
IUPAC Name: (2S,3R,3aS,6S,6a'S,6b'S,7aR,12a'S,12b'R)-3,6,11',12b'-tetramethyl-1',2',3a,4,5,5',6,6',6a',6b',7,7a,7',8',10',12',12a',12b'-octadecahydro-3H,3'H-spiro[furo[3,2-b]pyridine-2,9'-naphtho[2,1-a]azulen]-3'-one
InChIKey: MQLNLMKPNAHPDZ-LLMUXGIESA-N
SMILES: O=C1CC[C@]2(C)[C@@]3([H])CC4=C(C)C[C@]([C@@H]5C)(CC[C@@]4([H])[C@]3([H])CCC2=C1)O[C@@]6([H])[C@@]5([H])NC[C@@H](C)C6
Biological Activity: IPI-269609 is an orally effective Smoothed (SMO) inhibitor that targets the Hedgehog (Hh) signaling pathway. IPI-269609 specifically reduces the ALDH-bright (high aldehyde dehydrogenase activity) cell subset, which is considered the "cancer stem cells" in pancreatic cancer. IPI-269609 significantly inhibits the migration and colony formation of pancreatic cancer cells. IPI-269609 effectively inhibits pancreatic cancer metastasis in a mouse model. IPI-269609 can be used for pancreatic cancer research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
IPI-269609 | IPI-269609 is an orally effective Smoothed (SMO) inhibitor that targets the Hedgehog (Hh) signaling pathway. IPI-269609 specifically reduces the ALDH-bright (high aldehyde dehydrogenase activity) cell subset, which is considered the "cancer stem cells" in pancreatic cancer. IPI-269609 significantly inhibits the migration and colony formation of pancreatic cancer cells. IPI-269609 effectively inhibits pancreatic cancer metastasis in a mouse model. IPI-269609 can be used for pancreatic cancer research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
