890090-41-2
Chemical Structure
FAM NHS ester, 6-isomer
- CAS No.: 890090-41-2
- Formula:C25H15NO9
- Molecular Weight:473.39
InChIKey: LXFOCXWFKJWFEP-UHFFFAOYSA-N
SMILES: O=C1C=CC2=C(C3=C(C(O)=O)C=CC(C(ON4C(CCC4=O)=O)=O)=C3)C5=C(C=C(C=C5)O)OC2=C1
Biological Activity: FAM NHS ester, 6-isomer is a hydrophilic fluorophore. The NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residue or aminosilane-coated surfaces at neutral or slight basic conditions to form a covalent bond.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
FAM NHS ester, 6-isomer | FAM NHS ester, 6-isomer is a hydrophilic fluorophore. The NHS ester can react specifically and efficiently with primary amines such as the side chain of lysine residue or aminosilane-coated surfaces at neutral or slight basic conditions to form a covalent bond. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||