89595-71-1
Chemical Structure
Chamaejasmenin B
- CAS No.: 89595-71-1
- Formula:C32H26O10
- Molecular Weight:570.54
IUPAC Name: (2S,2'S,3S,3'S)-5,5',7,7'-tetrahydroxy-2,2'-bis(4-methoxyphenyl)-[3,3'-bichromane]-4,4'-dione
InChIKey: BTCICADMSGBCKA-QWWQXMGCSA-N
SMILES: O=C1[C@]([C@@]2([H])[C@@H](C(C=C3)=CC=C3OC)OC4=CC(O)=CC(O)=C4C2=O)([H])[C@@H](C(C=C5)=CC=C5OC)OC6=CC(O)=CC(O)=C16
Biological Activity: Chamaejasmenin B can be extracted from Stellera chamaejasme L. Chamaejasmenin B suppresses cancer cells migration and invasion. Chamaejasmenin B inhibits tumor metastasis. Chamaejasmenin B can be used in the research of cancers, such as breast cancers[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chamaejasmenin B | 98.0% | Chamaejasmenin B can be extracted from Stellera chamaejasme L. Chamaejasmenin B suppresses cancer cells migration and invasion. Chamaejasmenin B inhibits tumor metastasis. Chamaejasmenin B can be used in the research of cancers, such as breast cancers. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
- [1]. Li Q, et al. Chamaejasmenin B, a novel candidate, inhibits breast tumor metastasis by rebalancing TGF-beta paradox. Oncotarget. 2016 Jul 26;7(30):48180-48192. [Content Brief]
- [2]. Li Q, et al. Chamaejasmenin B, an Inhibitor for Metastatic Outgrowth, Reversed M2-Dominant Macrophage Polarization in Breast Tumor Microenvironment. Front Immunol. 2021 Dec 28;12:774230. [Content Brief]