92216-41-6
Chemical Structure
Balanophonin B
- CAS No.: 92216-41-6
- Formula:C20H20O7
- Molecular Weight:372.37
InChIKey: JOVBAVJQHJYOID-MDVLYUJXSA-N
SMILES: O=C1[C@@]2([H])[C@@](CO[C@@H]2C3=CC(OC)=C(C=C3)O)([H])[C@@H](C4=CC(OC)=C(C=C4)O)O1
Biological Activity: Balanophonin B is a selective inhibitor (IC50=1.46 μg/mL) that targets the lipopolysaccharide (LPS)-induced nitric oxide (NO) production pathway and can be isolated from Lithocarpus pachylepis. Balanophonin B inhibits the production of NO in LPS-stimulated RAW264.7 macrophages and exerts anti-inflammatory activity to reduce the inflammatory response. Balanophonin B can be used for anti-inflammatory drug development and biological activity research of natural lignan compounds[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Balanophonin B | Balanophonin B is a selective inhibitor (IC50=1.46 μg/mL) that targets the lipopolysaccharide (LPS)-induced nitric oxide (NO) production pathway and can be isolated from Lithocarpus pachylepis. Balanophonin B inhibits the production of NO in LPS-stimulated RAW264.7 macrophages and exerts anti-inflammatory activity to reduce the inflammatory response. Balanophonin B can be used for anti-inflammatory drug development and biological activity research of natural lignan compounds. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
