93781-75-0
Chemical Structure
Macrocalin B
- CAS. Nr.: 93781-75-0
- Formula:C20H26O6
- Molecular Weight:362.42
IUPAC Name: (1S,2S,4S,5S,6aS,8S,9S,9aR,13aR,14R)-2,8,9-trihydroxy-10,10-dimethyl-16-methylenedecahydro-1H,6aH,8H-1,5,8,4-(epipropane[1,1,1,3]tetrayl)oxocino[3,2-j]isochromen-15-one
InChIKey: GSRZMSWBSLHHAD-GJWLLTOMSA-N
SMILES: O[C@@]12[C@]34[C@]5([H])[C@]6([C@](C(C)(CCC6)C)([H])[C@@H]2O)[C@](O[C@@]3([H])[C@](C[C@@H]5O)([H])C(C4=O)=C)([H])O1
Biological Activity: Macrocalin B is a diterpenoid, which can be isolated from Isodon xerophilus. Macrocalin B inhibits the proliferation of cancer cells K562, HL-60, A549, MKN, CA and HCT with IC50 of 2.81-171 μM. Macrocalin B inhibits the telomerase in K562 with an IC50 in nanomolar level[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Macrocalin B | Macrocalin B is a diterpenoid, which can be isolated from Isodon xerophilus. Macrocalin B inhibits the proliferation of cancer cells K562, HL-60, A549, MKN, CA and HCT with IC50 of 2.81-171 μM. Macrocalin B inhibits the telomerase in K562 with an IC50 in nanomolar level. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
